C30H49NO6 — CID 140901474
(6R)-6-[(3R,10S,13R)-3-[(2S)-2-amino-3-carboxypropanoyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid (PubChem CID 140901474) has the molecular formula C30H49NO6 and a molecular weight of 519.72 g/mol. Its IUPAC name is (6R)-6-[(3R,10S,13R)-3-[(2S)-2-amino-3-carboxypropanoyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid.
| Compound Name | (6R)-6-[(3R,10S,13R)-3-[(2S)-2-amino-3-carboxypropanoyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
|---|---|
| PubChem CID | 140901474 |
| Molecular Formula | C30H49NO6 |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.36 |
| IUPAC Name | (6R)-6-[(3R,10S,13R)-3-[(2S)-2-amino-3-carboxypropanoyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
| SMILES | C[C@H](CCCCC(=O)O)C1CCC2C3CCC4C[C@H](OC(=O)[C@@H](N)CC(=O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H49NO6/c1-18(6-4-5-7-26(32)33)22-10-11-23-21-9-8-19-16-20(37-28(36)25(31)17-27(34)35)12-14-29(19,2)24(21)13-15-30(22,23)3/h18-25H,4-17,31H2,1-3H3,(H,32,33)(H,34,35)/t18-,19?,20-,21?,22?,23?,24?,25+,29+,30-/m1/s1 |
| InChIKey | JXXUNBZJWDNLBH-OUDFTXGDSA-N |
| XLogP | 5.64 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|