C29H46INO6 — CID 126640800
(6R)-6-[(3R)-3-[(2S)-2-amino-3-carboxypropanoyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-iodohexanoic acid (PubChem CID 126640800) has the molecular formula C29H46INO6 and a molecular weight of 631.59 g/mol. Its IUPAC name is (6R)-6-[(3R)-3-[(2S)-2-amino-3-carboxypropanoyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-iodohexanoic acid.
| Compound Name | (6R)-6-[(3R)-3-[(2S)-2-amino-3-carboxypropanoyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-iodohexanoic acid |
|---|---|
| PubChem CID | 126640800 |
| Molecular Formula | C29H46INO6 |
| Molecular Weight | 631.59 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | (6R)-6-[(3R)-3-[(2S)-2-amino-3-carboxypropanoyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-iodohexanoic acid |
| SMILES | CC12CC[C@@H](OC(=O)[C@@H](N)CC(=O)O)CC1CCC1C2CCC2(C)C1CCC2[C@H](I)CCCCC(=O)O |
| InChI | InChI=1S/C29H46INO6/c1-28-13-11-18(37-27(36)24(31)16-26(34)35)15-17(28)7-8-19-20-9-10-22(29(20,2)14-12-21(19)28)23(30)5-3-4-6-25(32)33/h17-24H,3-16,31H2,1-2H3,(H,32,33)(H,34,35)/t17?,18-,19?,20?,21?,22?,23-,24+,28?,29?/m1/s1 |
| InChIKey | DQPHWXAAINQNTH-DYINAKPRSA-N |
| XLogP | 5.81 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|