C24H38O2 — CID 126641276
(4R)-4-[(9S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 126641276) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is (4R)-4-[(9S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(9S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 126641276 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | (4R)-4-[(9S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)C1CC[C@H]2C3CCC4CCCCC4(C)[C@H]3C=CC12C |
| InChI | InChI=1S/C24H38O2/c1-16(7-12-22(25)26)19-10-11-20-18-9-8-17-6-4-5-14-23(17,2)21(18)13-15-24(19,20)3/h13,15-21H,4-12,14H2,1-3H3,(H,25,26)/t16-,17?,18?,19?,20+,21+,23?,24?/m1/s1 |
| InChIKey | AJPSTQMYBCEBQR-AQKNZBFCSA-N |
| XLogP | 6.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|