C24H38O6 — CID 45044733
2-[2-carboxy-3-[(2R)-4-carboxybutan-2-yl]-2-methylcyclopentyl]-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1-carboxylic acid (PubChem CID 45044733) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is 2-[2-carboxy-3-[(2R)-4-carboxybutan-2-yl]-2-methylcyclopentyl]-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1-carboxylic acid.
| Compound Name | 2-[2-carboxy-3-[(2R)-4-carboxybutan-2-yl]-2-methylcyclopentyl]-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 45044733 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2-[2-carboxy-3-[(2R)-4-carboxybutan-2-yl]-2-methylcyclopentyl]-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1-carboxylic acid |
| SMILES | C[C@H](CCC(=O)O)C1CCC(C2CCC3CCCCC3(C)C2C(=O)O)C1(C)C(=O)O |
| InChI | InChI=1S/C24H38O6/c1-14(7-12-19(25)26)17-10-11-18(24(17,3)22(29)30)16-9-8-15-6-4-5-13-23(15,2)20(16)21(27)28/h14-18,20H,4-13H2,1-3H3,(H,25,26)(H,27,28)(H,29,30)/t14-,15?,16?,17?,18?,20?,23?,24?/m1/s1 |
| InChIKey | YNMXEGGDGUBZKG-AZOIQFMQSA-N |
| XLogP | 4.91 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |