C12H10BrF3N2O3 — CID 126643137
(2S,4R)-2-[(3-bromo-2,4-difluorophenyl)carbamoyl]-4-fluoropyrrolidine-1-carboxylic acid (PubChem CID 126643137) has the molecular formula C12H10BrF3N2O3 and a molecular weight of 367.12 g/mol. Its IUPAC name is (2S,4R)-2-[(3-bromo-2,4-difluorophenyl)carbamoyl]-4-fluoropyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-2-[(3-bromo-2,4-difluorophenyl)carbamoyl]-4-fluoropyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 126643137 |
| Molecular Formula | C12H10BrF3N2O3 |
| Molecular Weight | 367.12 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | (2S,4R)-2-[(3-bromo-2,4-difluorophenyl)carbamoyl]-4-fluoropyrrolidine-1-carboxylic acid |
| SMILES | O=C(Nc1ccc(F)c(Br)c1F)[C@@H]1C[C@@H](F)CN1C(=O)O |
| InChI | InChI=1S/C12H10BrF3N2O3/c13-9-6(15)1-2-7(10(9)16)17-11(19)8-3-5(14)4-18(8)12(20)21/h1-2,5,8H,3-4H2,(H,17,19)(H,20,21)/t5-,8+/m1/s1 |
| InChIKey | KJCWKYVHNRQGPU-XRGYYRRGSA-N |
| XLogP | 2.76 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.12 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|