C12H24N2O4 — CID 126643714
2-[2-(diethylamino)ethyl]pyrrolidine-1-carboxylic acid;formic acid (PubChem CID 126643714) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethyl]pyrrolidine-1-carboxylic acid;formic acid.
| Compound Name | 2-[2-(diethylamino)ethyl]pyrrolidine-1-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 126643714 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-[2-(diethylamino)ethyl]pyrrolidine-1-carboxylic acid;formic acid |
| SMILES | CCN(CC)CCC1CCCN1C(=O)O.O=CO |
| InChI | InChI=1S/C11H22N2O2.CH2O2/c1-3-12(4-2)9-7-10-6-5-8-13(10)11(14)15;2-1-3/h10H,3-9H2,1-2H3,(H,14,15);1H,(H,2,3) |
| InChIKey | VLCVFWZXIKKKDC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|