C17H16FN3O2S — CID 126644895
1-[4-[(4-fluoro-1,3-benzothiazol-2-yl)oxy]phenyl]-3-propan-2-ylurea (PubChem CID 126644895) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-[4-[(4-fluoro-1,3-benzothiazol-2-yl)oxy]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[(4-fluoro-1,3-benzothiazol-2-yl)oxy]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 126644895 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-[4-[(4-fluoro-1,3-benzothiazol-2-yl)oxy]phenyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1ccc(Oc2nc3c(F)cccc3s2)cc1 |
| InChI | InChI=1S/C17H16FN3O2S/c1-10(2)19-16(22)20-11-6-8-12(9-7-11)23-17-21-15-13(18)4-3-5-14(15)24-17/h3-10H,1-2H3,(H2,19,20,22) |
| InChIKey | NZGWLOVOPVLMFL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |