C14H23N3O3 — CID 126647448
3-[2-(1H-imidazol-5-yl)ethylcarbamoyl]-2,2,4-trimethylpentanoic acid (PubChem CID 126647448) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[2-(1H-imidazol-5-yl)ethylcarbamoyl]-2,2,4-trimethylpentanoic acid.
| Compound Name | 3-[2-(1H-imidazol-5-yl)ethylcarbamoyl]-2,2,4-trimethylpentanoic acid |
|---|---|
| PubChem CID | 126647448 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3-[2-(1H-imidazol-5-yl)ethylcarbamoyl]-2,2,4-trimethylpentanoic acid |
| SMILES | CC(C)C(C(=O)NCCc1cnc[nH]1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H23N3O3/c1-9(2)11(14(3,4)13(19)20)12(18)16-6-5-10-7-15-8-17-10/h7-9,11H,5-6H2,1-4H3,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | WTKNGLFLRKVIQE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |