C20H17N3OS — CID 126648413
N-[[4-(6-thiophen-3-ylbenzimidazol-1-yl)phenyl]methyl]acetamide (PubChem CID 126648413) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[[4-(6-thiophen-3-ylbenzimidazol-1-yl)phenyl]methyl]acetamide.
| Compound Name | N-[[4-(6-thiophen-3-ylbenzimidazol-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 126648413 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[[4-(6-thiophen-3-ylbenzimidazol-1-yl)phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(-n2cnc3ccc(-c4ccsc4)cc32)cc1 |
| InChI | InChI=1S/C20H17N3OS/c1-14(24)21-11-15-2-5-18(6-3-15)23-13-22-19-7-4-16(10-20(19)23)17-8-9-25-12-17/h2-10,12-13H,11H2,1H3,(H,21,24) |
| InChIKey | JEVJBLNFKKCOLU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |