C18H19N3O3 — CID 126648449
5-N-cyclopropyl-3-N-methyl-2-phenylmethoxypyridine-3,5-dicarboxamide (PubChem CID 126648449) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-N-cyclopropyl-3-N-methyl-2-phenylmethoxypyridine-3,5-dicarboxamide.
| Compound Name | 5-N-cyclopropyl-3-N-methyl-2-phenylmethoxypyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 126648449 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 5-N-cyclopropyl-3-N-methyl-2-phenylmethoxypyridine-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NC2CC2)cnc1OCc1ccccc1 |
| InChI | InChI=1S/C18H19N3O3/c1-19-17(23)15-9-13(16(22)21-14-7-8-14)10-20-18(15)24-11-12-5-3-2-4-6-12/h2-6,9-10,14H,7-8,11H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | GVZHRRHRTSZRQR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |