C26H36O12 — CID 126649660
1-hydroxybutyl 4-hydroxy-3,5-dimethoxybenzoate;3-hydroxybutyl 4-hydroxy-3,5-dimethoxybenzoate (PubChem CID 126649660) has the molecular formula C26H36O12 and a molecular weight of 540.56 g/mol. Its IUPAC name is 1-hydroxybutyl 4-hydroxy-3,5-dimethoxybenzoate;3-hydroxybutyl 4-hydroxy-3,5-dimethoxybenzoate.
| Compound Name | 1-hydroxybutyl 4-hydroxy-3,5-dimethoxybenzoate;3-hydroxybutyl 4-hydroxy-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 126649660 |
| Molecular Formula | C26H36O12 |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 1-hydroxybutyl 4-hydroxy-3,5-dimethoxybenzoate;3-hydroxybutyl 4-hydroxy-3,5-dimethoxybenzoate |
| SMILES | CCCC(O)OC(=O)c1cc(OC)c(O)c(OC)c1.COc1cc(C(=O)OCCC(C)O)cc(OC)c1O |
| InChI | InChI=1S/2C13H18O6/c1-8(14)4-5-19-13(16)9-6-10(17-2)12(15)11(7-9)18-3;1-4-5-11(14)19-13(16)8-6-9(17-2)12(15)10(7-8)18-3/h6-8,14-15H,4-5H2,1-3H3;6-7,11,14-15H,4-5H2,1-3H3 |
| InChIKey | IQLOIJPMMMNYRX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 170.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|