C27H30N4O2 — CID 126651046
7-[3-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)phenyl]-2-(morpholin-4-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine (PubChem CID 126651046) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 7-[3-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)phenyl]-2-(morpholin-4-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine.
| Compound Name | 7-[3-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)phenyl]-2-(morpholin-4-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine |
|---|---|
| PubChem CID | 126651046 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 7-[3-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)phenyl]-2-(morpholin-4-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine |
| SMILES | CC1CC(c2cccc(-c3ccc4c(c3)OCc3nc(CN5CCOCC5)cn3-4)c2)=CCN1 |
| InChI | InChI=1S/C27H30N4O2/c1-19-13-23(7-8-28-19)21-4-2-3-20(14-21)22-5-6-25-26(15-22)33-18-27-29-24(17-31(25)27)16-30-9-11-32-12-10-30/h2-7,14-15,17,19,28H,8-13,16,18H2,1H3 |
| InChIKey | BKZHPCMTVDRYOT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |