C33H35N3O4 — CID 126651087
5-O-tert-butyl 3-O-ethyl 4-trityl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxylate (PubChem CID 126651087) has the molecular formula C33H35N3O4 and a molecular weight of 537.66 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O-ethyl 4-trityl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 3-O-ethyl 4-trityl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 126651087 |
| Molecular Formula | C33H35N3O4 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 5-O-tert-butyl 3-O-ethyl 4-trityl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1n[nH]c2c1C(C(c1ccccc1)(c1ccccc1)c1ccccc1)N(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C33H35N3O4/c1-5-39-30(37)28-27-26(34-35-28)21-22-36(31(38)40-32(2,3)4)29(27)33(23-15-9-6-10-16-23,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,29H,5,21-22H2,1-4H3,(H,34,35) |
| InChIKey | QAWBTEKDGDOGQW-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|