C23H27N5O — CID 126654255
3,3-dimethyl-1-[(9S)-4,5,13-trimethyl-7-phenyl-1,4,8,11,12-pentazatricyclo[8.3.0.02,6]trideca-2,5,7,10,12-pentaen-9-yl]butan-2-one (PubChem CID 126654255) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(9S)-4,5,13-trimethyl-7-phenyl-1,4,8,11,12-pentazatricyclo[8.3.0.02,6]trideca-2,5,7,10,12-pentaen-9-yl]butan-2-one.
| Compound Name | 3,3-dimethyl-1-[(9S)-4,5,13-trimethyl-7-phenyl-1,4,8,11,12-pentazatricyclo[8.3.0.02,6]trideca-2,5,7,10,12-pentaen-9-yl]butan-2-one |
|---|---|
| PubChem CID | 126654255 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 3,3-dimethyl-1-[(9S)-4,5,13-trimethyl-7-phenyl-1,4,8,11,12-pentazatricyclo[8.3.0.02,6]trideca-2,5,7,10,12-pentaen-9-yl]butan-2-one |
| SMILES | Cc1c2c(cn1C)-n1c(C)nnc1[C@H](CC(=O)C(C)(C)C)N=C2c1ccccc1 |
| InChI | InChI=1S/C23H27N5O/c1-14-20-18(13-27(14)6)28-15(2)25-26-22(28)17(12-19(29)23(3,4)5)24-21(20)16-10-8-7-9-11-16/h7-11,13,17H,12H2,1-6H3/t17-/m0/s1 |
| InChIKey | VLZDIOWEEHJNBD-KRWDZBQOSA-N |
| XLogP | 4.12 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |