C22H24N4OS — CID 135273184
1-[(9S)-4,5-dimethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-3,3-dimethylbutan-2-one (PubChem CID 135273184) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 1-[(9S)-4,5-dimethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[(9S)-4,5-dimethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 135273184 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[(9S)-4,5-dimethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-3,3-dimethylbutan-2-one |
| SMILES | Cc1sc2c(c1C)C(c1ccccc1)=N[C@@H](CC(=O)C(C)(C)C)c1nncn1-2 |
| InChI | InChI=1S/C22H24N4OS/c1-13-14(2)28-21-18(13)19(15-9-7-6-8-10-15)24-16(11-17(27)22(3,4)5)20-25-23-12-26(20)21/h6-10,12,16H,11H2,1-5H3/t16-/m0/s1 |
| InChIKey | SWPBCKRYKPHASX-INIZCTEOSA-N |
| XLogP | 4.84 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |