C26H25N5O2S — CID 67446034
2-[(9S)-7-[4-(benzylamino)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid (PubChem CID 67446034) has the molecular formula C26H25N5O2S and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-[(9S)-7-[4-(benzylamino)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid.
| Compound Name | 2-[(9S)-7-[4-(benzylamino)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
|---|---|
| PubChem CID | 67446034 |
| Molecular Formula | C26H25N5O2S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[(9S)-7-[4-(benzylamino)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
| SMILES | Cc1sc2c(c1C)C(c1ccc(NCc3ccccc3)cc1)=N[C@@H](CC(=O)O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C26H25N5O2S/c1-15-16(2)34-26-23(15)24(28-21(13-22(32)33)25-30-29-17(3)31(25)26)19-9-11-20(12-10-19)27-14-18-7-5-4-6-8-18/h4-12,21,27H,13-14H2,1-3H3,(H,32,33)/t21-/m0/s1 |
| InChIKey | GOCZRYGCULMVPF-NRFANRHFSA-N |
| XLogP | 5.23 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |