C23H23N5O2S — CID 146450787
2-[(9R)-4,5,13-trimethyl-7-[4-[3-(methylamino)prop-1-ynyl]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid (PubChem CID 146450787) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 2-[(9R)-4,5,13-trimethyl-7-[4-[3-(methylamino)prop-1-ynyl]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid.
| Compound Name | 2-[(9R)-4,5,13-trimethyl-7-[4-[3-(methylamino)prop-1-ynyl]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
|---|---|
| PubChem CID | 146450787 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-[(9R)-4,5,13-trimethyl-7-[4-[3-(methylamino)prop-1-ynyl]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
| SMILES | CNCC#Cc1ccc(C2=N[C@H](CC(=O)O)c3nnc(C)n3-c3sc(C)c(C)c32)cc1 |
| InChI | InChI=1S/C23H23N5O2S/c1-13-14(2)31-23-20(13)21(17-9-7-16(8-10-17)6-5-11-24-4)25-18(12-19(29)30)22-27-26-15(3)28(22)23/h7-10,18,24H,11-12H2,1-4H3,(H,29,30)/t18-/m1/s1 |
| InChIKey | CLIDNYGSBRPTTB-GOSISDBHSA-N |
| XLogP | 3.19 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|