C30H33N5O2S — CID 90773631
methyl 2-[(9S)-4,5,13-trimethyl-7-[4-(4-phenylbutylamino)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 90773631) has the molecular formula C30H33N5O2S and a molecular weight of 527.69 g/mol. Its IUPAC name is methyl 2-[(9S)-4,5,13-trimethyl-7-[4-(4-phenylbutylamino)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | methyl 2-[(9S)-4,5,13-trimethyl-7-[4-(4-phenylbutylamino)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 90773631 |
| Molecular Formula | C30H33N5O2S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | methyl 2-[(9S)-4,5,13-trimethyl-7-[4-(4-phenylbutylamino)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | COC(=O)C[C@@H]1N=C(c2ccc(NCCCCc3ccccc3)cc2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C30H33N5O2S/c1-19-20(2)38-30-27(19)28(32-25(18-26(36)37-4)29-34-33-21(3)35(29)30)23-13-15-24(16-14-23)31-17-9-8-12-22-10-6-5-7-11-22/h5-7,10-11,13-16,25,31H,8-9,12,17-18H2,1-4H3/t25-/m0/s1 |
| InChIKey | PGXXKMXNLCWVAG-VWLOTQADSA-N |
| XLogP | 6.14 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|