C18H25NO3 — CID 126654823
2-methyl-1-[6-[(2R)-1-(propan-2-ylamino)propan-2-yl]oxy-1-benzofuran-2-yl]propan-1-one (PubChem CID 126654823) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-methyl-1-[6-[(2R)-1-(propan-2-ylamino)propan-2-yl]oxy-1-benzofuran-2-yl]propan-1-one.
| Compound Name | 2-methyl-1-[6-[(2R)-1-(propan-2-ylamino)propan-2-yl]oxy-1-benzofuran-2-yl]propan-1-one |
|---|---|
| PubChem CID | 126654823 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-methyl-1-[6-[(2R)-1-(propan-2-ylamino)propan-2-yl]oxy-1-benzofuran-2-yl]propan-1-one |
| SMILES | CC(C)NC[C@@H](C)Oc1ccc2cc(C(=O)C(C)C)oc2c1 |
| InChI | InChI=1S/C18H25NO3/c1-11(2)18(20)17-8-14-6-7-15(9-16(14)22-17)21-13(5)10-19-12(3)4/h6-9,11-13,19H,10H2,1-5H3/t13-/m1/s1 |
| InChIKey | GVEFYTAHUDESSR-CYBMUJFWSA-N |
| XLogP | 4.04 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |