C18H23NO3S — CID 135278906
2-methyl-1-[6-[3-(1-sulfanylethylamino)cyclobutyl]oxy-1-benzofuran-2-yl]propan-1-one (PubChem CID 135278906) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 2-methyl-1-[6-[3-(1-sulfanylethylamino)cyclobutyl]oxy-1-benzofuran-2-yl]propan-1-one.
| Compound Name | 2-methyl-1-[6-[3-(1-sulfanylethylamino)cyclobutyl]oxy-1-benzofuran-2-yl]propan-1-one |
|---|---|
| PubChem CID | 135278906 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2-methyl-1-[6-[3-(1-sulfanylethylamino)cyclobutyl]oxy-1-benzofuran-2-yl]propan-1-one |
| SMILES | CC(S)NC1CC(Oc2ccc3cc(C(=O)C(C)C)oc3c2)C1 |
| InChI | InChI=1S/C18H23NO3S/c1-10(2)18(20)17-6-12-4-5-14(9-16(12)22-17)21-15-7-13(8-15)19-11(3)23/h4-6,9-11,13,15,19,23H,7-8H2,1-3H3 |
| InChIKey | CJKGFNUUVCAITJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|