C18H26FNO2S — CID 135216912
1-[3-fluoro-5-[3-(1-sulfanylethylamino)cyclobutyl]oxyphenyl]-4-methylpentan-3-one (PubChem CID 135216912) has the molecular formula C18H26FNO2S and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-[3-fluoro-5-[3-(1-sulfanylethylamino)cyclobutyl]oxyphenyl]-4-methylpentan-3-one.
| Compound Name | 1-[3-fluoro-5-[3-(1-sulfanylethylamino)cyclobutyl]oxyphenyl]-4-methylpentan-3-one |
|---|---|
| PubChem CID | 135216912 |
| Molecular Formula | C18H26FNO2S |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-[3-fluoro-5-[3-(1-sulfanylethylamino)cyclobutyl]oxyphenyl]-4-methylpentan-3-one |
| SMILES | CC(S)NC1CC(Oc2cc(F)cc(CCC(=O)C(C)C)c2)C1 |
| InChI | InChI=1S/C18H26FNO2S/c1-11(2)18(21)5-4-13-6-14(19)8-16(7-13)22-17-9-15(10-17)20-12(3)23/h6-8,11-12,15,17,20,23H,4-5,9-10H2,1-3H3 |
| InChIKey | MVDHZMQSQSSDOF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|