C18H26FNO3 — CID 135167802
[3-fluoro-5-[3-(propan-2-ylamino)cyclobutyl]oxyphenyl]methyl 2-methylpropanoate (PubChem CID 135167802) has the molecular formula C18H26FNO3 and a molecular weight of 323.41 g/mol. Its IUPAC name is [3-fluoro-5-[3-(propan-2-ylamino)cyclobutyl]oxyphenyl]methyl 2-methylpropanoate.
| Compound Name | [3-fluoro-5-[3-(propan-2-ylamino)cyclobutyl]oxyphenyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 135167802 |
| Molecular Formula | C18H26FNO3 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | [3-fluoro-5-[3-(propan-2-ylamino)cyclobutyl]oxyphenyl]methyl 2-methylpropanoate |
| SMILES | CC(C)NC1CC(Oc2cc(F)cc(COC(=O)C(C)C)c2)C1 |
| InChI | InChI=1S/C18H26FNO3/c1-11(2)18(21)22-10-13-5-14(19)7-16(6-13)23-17-8-15(9-17)20-12(3)4/h5-7,11-12,15,17,20H,8-10H2,1-4H3 |
| InChIKey | XVLDLAULRVVYQF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |