C16H24N2O2S — CID 167293098
S-methyl 3-[2-[3-(propan-2-ylamino)cyclobutyl]oxy-4-pyridinyl]propanethioate (PubChem CID 167293098) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is S-methyl 3-[2-[3-(propan-2-ylamino)cyclobutyl]oxy-4-pyridinyl]propanethioate.
| Compound Name | S-methyl 3-[2-[3-(propan-2-ylamino)cyclobutyl]oxy-4-pyridinyl]propanethioate |
|---|---|
| PubChem CID | 167293098 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | S-methyl 3-[2-[3-(propan-2-ylamino)cyclobutyl]oxy-4-pyridinyl]propanethioate |
| SMILES | CSC(=O)CCc1ccnc(OC2CC(NC(C)C)C2)c1 |
| InChI | InChI=1S/C16H24N2O2S/c1-11(2)18-13-9-14(10-13)20-15-8-12(6-7-17-15)4-5-16(19)21-3/h6-8,11,13-14,18H,4-5,9-10H2,1-3H3 |
| InChIKey | UJIYPZKJTGIZHP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|