C16H22FNO3S — CID 134582859
S-methyl 2-[3-fluoro-5-[3-(propan-2-ylamino)cyclobutyl]oxyphenoxy]ethanethioate (PubChem CID 134582859) has the molecular formula C16H22FNO3S and a molecular weight of 327.42 g/mol. Its IUPAC name is S-methyl 2-[3-fluoro-5-[3-(propan-2-ylamino)cyclobutyl]oxyphenoxy]ethanethioate.
| Compound Name | S-methyl 2-[3-fluoro-5-[3-(propan-2-ylamino)cyclobutyl]oxyphenoxy]ethanethioate |
|---|---|
| PubChem CID | 134582859 |
| Molecular Formula | C16H22FNO3S |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | S-methyl 2-[3-fluoro-5-[3-(propan-2-ylamino)cyclobutyl]oxyphenoxy]ethanethioate |
| SMILES | CSC(=O)COc1cc(F)cc(OC2CC(NC(C)C)C2)c1 |
| InChI | InChI=1S/C16H22FNO3S/c1-10(2)18-12-6-15(7-12)21-14-5-11(17)4-13(8-14)20-9-16(19)22-3/h4-5,8,10,12,15,18H,6-7,9H2,1-3H3 |
| InChIKey | JCSNTVUOZFGPKC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|