C19H29NO2 — CID 135174776
2,2-dimethyl-4-[3-[3-(propan-2-ylamino)cyclobutyl]oxyphenyl]butanal (PubChem CID 135174776) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 2,2-dimethyl-4-[3-[3-(propan-2-ylamino)cyclobutyl]oxyphenyl]butanal.
| Compound Name | 2,2-dimethyl-4-[3-[3-(propan-2-ylamino)cyclobutyl]oxyphenyl]butanal |
|---|---|
| PubChem CID | 135174776 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 2,2-dimethyl-4-[3-[3-(propan-2-ylamino)cyclobutyl]oxyphenyl]butanal |
| SMILES | CC(C)NC1CC(Oc2cccc(CCC(C)(C)C=O)c2)C1 |
| InChI | InChI=1S/C19H29NO2/c1-14(2)20-16-11-18(12-16)22-17-7-5-6-15(10-17)8-9-19(3,4)13-21/h5-7,10,13-14,16,18,20H,8-9,11-12H2,1-4H3 |
| InChIKey | NZZTYQBPLVEXTL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|