C20H30O2 — CID 126640524
5-[3-(4,4-dimethyl-5-oxopentyl)phenyl]-2,2-dimethylpentanal (PubChem CID 126640524) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 5-[3-(4,4-dimethyl-5-oxopentyl)phenyl]-2,2-dimethylpentanal.
| Compound Name | 5-[3-(4,4-dimethyl-5-oxopentyl)phenyl]-2,2-dimethylpentanal |
|---|---|
| PubChem CID | 126640524 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 5-[3-(4,4-dimethyl-5-oxopentyl)phenyl]-2,2-dimethylpentanal |
| SMILES | CC(C)(C=O)CCCc1cccc(CCCC(C)(C)C=O)c1 |
| InChI | InChI=1S/C20H30O2/c1-19(2,15-21)12-6-10-17-8-5-9-18(14-17)11-7-13-20(3,4)16-22/h5,8-9,14-16H,6-7,10-13H2,1-4H3 |
| InChIKey | VFMCJKIKFKAEFX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|