C14H22Br2 — CID 155596477
1,3-bis(3-bromopropyl)benzene;ethane (PubChem CID 155596477) has the molecular formula C14H22Br2 and a molecular weight of 350.14 g/mol. Its IUPAC name is 1,3-bis(3-bromopropyl)benzene;ethane.
| Compound Name | 1,3-bis(3-bromopropyl)benzene;ethane |
|---|---|
| PubChem CID | 155596477 |
| Molecular Formula | C14H22Br2 |
| Molecular Weight | 350.14 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 1,3-bis(3-bromopropyl)benzene;ethane |
| SMILES | BrCCCc1cccc(CCCBr)c1.CC |
| InChI | InChI=1S/C12H16Br2.C2H6/c13-8-2-6-11-4-1-5-12(10-11)7-3-9-14;1-2/h1,4-5,10H,2-3,6-9H2;1-2H3 |
| InChIKey | UOIVWDJQPZZGMM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.14 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|