C17H29N — CID 71016135
3-[3-(2,2-dimethylhexyl)phenyl]propan-1-amine (PubChem CID 71016135) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 3-[3-(2,2-dimethylhexyl)phenyl]propan-1-amine.
| Compound Name | 3-[3-(2,2-dimethylhexyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 71016135 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 3-[3-(2,2-dimethylhexyl)phenyl]propan-1-amine |
| SMILES | CCCCC(C)(C)Cc1cccc(CCCN)c1 |
| InChI | InChI=1S/C17H29N/c1-4-5-11-17(2,3)14-16-9-6-8-15(13-16)10-7-12-18/h6,8-9,13H,4-5,7,10-12,14,18H2,1-3H3 |
| InChIKey | UIPASDBCTJNOPJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |