C20H31NO — CID 25166543
5-[2-[3-(3-aminopropyl)phenyl]ethynyl]nonan-5-ol (PubChem CID 25166543) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is 5-[2-[3-(3-aminopropyl)phenyl]ethynyl]nonan-5-ol.
| Compound Name | 5-[2-[3-(3-aminopropyl)phenyl]ethynyl]nonan-5-ol |
|---|---|
| PubChem CID | 25166543 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 5-[2-[3-(3-aminopropyl)phenyl]ethynyl]nonan-5-ol |
| SMILES | CCCCC(O)(C#Cc1cccc(CCCN)c1)CCCC |
| InChI | InChI=1S/C20H31NO/c1-3-5-13-20(22,14-6-4-2)15-12-19-10-7-9-18(17-19)11-8-16-21/h7,9-10,17,22H,3-6,8,11,13-14,16,21H2,1-2H3 |
| InChIKey | WFTRZUBFVAFOLT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|