C19H33NO — CID 42610459
3-[3-(3-methoxy-3-propylhexyl)phenyl]propan-1-amine (PubChem CID 42610459) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 3-[3-(3-methoxy-3-propylhexyl)phenyl]propan-1-amine.
| Compound Name | 3-[3-(3-methoxy-3-propylhexyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 42610459 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 3-[3-(3-methoxy-3-propylhexyl)phenyl]propan-1-amine |
| SMILES | CCCC(CCC)(CCc1cccc(CCCN)c1)OC |
| InChI | InChI=1S/C19H33NO/c1-4-12-19(21-3,13-5-2)14-11-18-9-6-8-17(16-18)10-7-15-20/h6,8-9,16H,4-5,7,10-15,20H2,1-3H3 |
| InChIKey | YXIWXSFXFTUOGG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |