C16H22F2N2O2 — CID 46029174
3-[(3,5-difluorophenyl)methoxy]-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 46029174) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-[(3,5-difluorophenyl)methoxy]-N-propan-2-ylpiperidine-1-carboxamide.
| Compound Name | 3-[(3,5-difluorophenyl)methoxy]-N-propan-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 46029174 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-[(3,5-difluorophenyl)methoxy]-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCCC(OCc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C16H22F2N2O2/c1-11(2)19-16(21)20-5-3-4-15(9-20)22-10-12-6-13(17)8-14(18)7-12/h6-8,11,15H,3-5,9-10H2,1-2H3,(H,19,21) |
| InChIKey | LSVIFTUYFSAIJH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |