C34H22N3OPS — CID 126655999
[2-(13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-yl)pyrimidin-5-yl]-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 126655999) has the molecular formula C34H22N3OPS and a molecular weight of 551.61 g/mol. Its IUPAC name is [2-(13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-yl)pyrimidin-5-yl]-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | [2-(13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-yl)pyrimidin-5-yl]-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 126655999 |
| Molecular Formula | C34H22N3OPS |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | [2-(13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-yl)pyrimidin-5-yl]-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | S=P(c1ccccc1)(c1ccccc1)c1cnc(-c2ccc3c(c2)Oc2cccc4c5ccccc5n-3c24)nc1 |
| InChI | InChI=1S/C34H22N3OPS/c40-39(24-10-3-1-4-11-24,25-12-5-2-6-13-25)26-21-35-34(36-22-26)23-18-19-30-32(20-23)38-31-17-9-15-28-27-14-7-8-16-29(27)37(30)33(28)31/h1-22H |
| InChIKey | WXPHTXVNAUWMLQ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|