C46H31N4PSe — CID 140776298
diphenyl-[4-[2-(13-phenyl-1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-yl)pyrimidin-5-yl]phenyl]-selanylidene-λ5-phosphane (PubChem CID 140776298) has the molecular formula C46H31N4PSe and a molecular weight of 749.72 g/mol. Its IUPAC name is diphenyl-[4-[2-(13-phenyl-1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-yl)pyrimidin-5-yl]phenyl]-selanylidene-λ5-phosphane.
| Compound Name | diphenyl-[4-[2-(13-phenyl-1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-yl)pyrimidin-5-yl]phenyl]-selanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 140776298 |
| Molecular Formula | C46H31N4PSe |
| Molecular Weight | 749.72 g/mol |
| Exact Mass | 750.15 |
| IUPAC Name | diphenyl-[4-[2-(13-phenyl-1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-yl)pyrimidin-5-yl]phenyl]-selanylidene-λ5-phosphane |
| SMILES | [Se]=P(c1ccccc1)(c1ccccc1)c1ccc(-c2cnc(-c3ccc4c(c3)N(c3ccccc3)c3cccc5c6ccccc6n-4c35)nc2)cc1 |
| InChI | InChI=1S/C46H31N4PSe/c52-51(36-15-6-2-7-16-36,37-17-8-3-9-18-37)38-26-23-32(24-27-38)34-30-47-46(48-31-34)33-25-28-42-44(29-33)49(35-13-4-1-5-14-35)43-22-12-20-40-39-19-10-11-21-41(39)50(42)45(40)43/h1-31H |
| InChIKey | WIBFPSOJOYZQBJ-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.72 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|