C7H14N2 — CID 126657421
(Z)-1-N-ethenyl-1-N-ethylprop-1-ene-1,2-diamine (PubChem CID 126657421) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (Z)-1-N-ethenyl-1-N-ethylprop-1-ene-1,2-diamine.
| Compound Name | (Z)-1-N-ethenyl-1-N-ethylprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 126657421 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (Z)-1-N-ethenyl-1-N-ethylprop-1-ene-1,2-diamine |
| SMILES | C=CN(/C=C(/C)N)CC |
| InChI | InChI=1S/C7H14N2/c1-4-9(5-2)6-7(3)8/h4,6H,1,5,8H2,2-3H3/b7-6- |
| InChIKey | GTBCGVYBHPAWPG-SREVYHEPSA-N |
| XLogP | 1.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |