C23H29N5O2S2 — CID 126662031
N-[2-[3-(2-aminoethyl)piperidin-1-yl]-4-(2-amino-2-hydroxyethyl)phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 126662031) has the molecular formula C23H29N5O2S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-[2-[3-(2-aminoethyl)piperidin-1-yl]-4-(2-amino-2-hydroxyethyl)phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[3-(2-aminoethyl)piperidin-1-yl]-4-(2-amino-2-hydroxyethyl)phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 126662031 |
| Molecular Formula | C23H29N5O2S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[2-[3-(2-aminoethyl)piperidin-1-yl]-4-(2-amino-2-hydroxyethyl)phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | NCCC1CCCN(c2cc(CC(N)O)ccc2NC(=O)c2csc(-c3cccs3)n2)C1 |
| InChI | InChI=1S/C23H29N5O2S2/c24-8-7-15-3-1-9-28(13-15)19-11-16(12-21(25)29)5-6-17(19)26-22(30)18-14-32-23(27-18)20-4-2-10-31-20/h2,4-6,10-11,14-15,21,29H,1,3,7-9,12-13,24-25H2,(H,26,30) |
| InChIKey | SDUNOEBNGYRWPC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|