C26H31N5O5S2 — CID 68853196
tert-butyl N-[2-[1-[4-nitro-2-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]phenyl]piperidin-3-yl]ethyl]carbamate (PubChem CID 68853196) has the molecular formula C26H31N5O5S2 and a molecular weight of 557.70 g/mol. Its IUPAC name is tert-butyl N-[2-[1-[4-nitro-2-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]phenyl]piperidin-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-[4-nitro-2-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]phenyl]piperidin-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 68853196 |
| Molecular Formula | C26H31N5O5S2 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | tert-butyl N-[2-[1-[4-nitro-2-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]phenyl]piperidin-3-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC1CCCN(c2ccc([N+](=O)[O-])cc2NC(=O)c2csc(-c3cccs3)n2)C1 |
| InChI | InChI=1S/C26H31N5O5S2/c1-26(2,3)36-25(33)27-11-10-17-6-4-12-30(15-17)21-9-8-18(31(34)35)14-19(21)28-23(32)20-16-38-24(29-20)22-7-5-13-37-22/h5,7-9,13-14,16-17H,4,6,10-12,15H2,1-3H3,(H,27,33)(H,28,32) |
| InChIKey | LXUPNKONHGPBLL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|