C31H42F2N4O5S — CID 126664290
[(2S)-1-[[(1S,2R)-2-[2-[(6R,9S)-2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclohexyl]amino]-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]carbamic acid (PubChem CID 126664290) has the molecular formula C31H42F2N4O5S and a molecular weight of 620.76 g/mol. Its IUPAC name is [(2S)-1-[[(1S,2R)-2-[2-[(6R,9S)-2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclohexyl]amino]-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[[(1S,2R)-2-[2-[(6R,9S)-2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclohexyl]amino]-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 126664290 |
| Molecular Formula | C31H42F2N4O5S |
| Molecular Weight | 620.76 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | [(2S)-1-[[(1S,2R)-2-[2-[(6R,9S)-2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclohexyl]amino]-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@H](C(=O)N[C@H]1CCCC[C@@H]1CC[C@H]1CN[C@@H]2CCCS(O)(O)N1C2)C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H42F2N4O5S/c32-23-12-7-21(8-13-23)28(22-9-14-24(33)15-10-22)29(36-31(39)40)30(38)35-27-6-2-1-4-20(27)11-16-26-18-34-25-5-3-17-43(41,42)37(26)19-25/h7-10,12-15,20,25-29,34,36,41-42H,1-6,11,16-19H2,(H,35,38)(H,39,40)/t20-,25-,26+,27+,29+/m1/s1 |
| InChIKey | IATJIHKLRZTJBP-GXXPTHJVSA-N |
| XLogP | 5.29 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.76 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |