C27H42ClFN4O4S — CID 126664665
3-(4-chloro-3-fluorophenyl)-N-[(1S,2R)-2-[2-[(6R,9S)-2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclopentyl]-3-morpholin-4-ylpropanamide (PubChem CID 126664665) has the molecular formula C27H42ClFN4O4S and a molecular weight of 573.18 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorophenyl)-N-[(1S,2R)-2-[2-[(6R,9S)-2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclopentyl]-3-morpholin-4-ylpropanamide.
| Compound Name | 3-(4-chloro-3-fluorophenyl)-N-[(1S,2R)-2-[2-[(6R,9S)-2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclopentyl]-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 126664665 |
| Molecular Formula | C27H42ClFN4O4S |
| Molecular Weight | 573.18 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 3-(4-chloro-3-fluorophenyl)-N-[(1S,2R)-2-[2-[(6R,9S)-2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclopentyl]-3-morpholin-4-ylpropanamide |
| SMILES | O=C(CC(c1ccc(Cl)c(F)c1)N1CCOCC1)N[C@H]1CCC[C@@H]1CC[C@H]1CN[C@@H]2CCCS(O)(O)N1C2 |
| InChI | InChI=1S/C27H42ClFN4O4S/c28-23-9-7-20(15-24(23)29)26(32-10-12-37-13-11-32)16-27(34)31-25-5-1-3-19(25)6-8-22-17-30-21-4-2-14-38(35,36)33(22)18-21/h7,9,15,19,21-22,25-26,30,35-36H,1-6,8,10-14,16-18H2,(H,31,34)/t19-,21-,22+,25+,26?/m1/s1 |
| InChIKey | GTXJRYYEDOBMME-CAPCJZOMSA-N |
| XLogP | 4.41 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.18 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |