C16H17FN2O3 — CID 126664331
(3S)-3-(4-fluorophenyl)-3-(2-propan-2-yloxypyrimidin-5-yl)propanoic acid (PubChem CID 126664331) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)-3-(2-propan-2-yloxypyrimidin-5-yl)propanoic acid.
| Compound Name | (3S)-3-(4-fluorophenyl)-3-(2-propan-2-yloxypyrimidin-5-yl)propanoic acid |
|---|---|
| PubChem CID | 126664331 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)-3-(2-propan-2-yloxypyrimidin-5-yl)propanoic acid |
| SMILES | CC(C)Oc1ncc([C@@H](CC(=O)O)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C16H17FN2O3/c1-10(2)22-16-18-8-12(9-19-16)14(7-15(20)21)11-3-5-13(17)6-4-11/h3-6,8-10,14H,7H2,1-2H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | ODAXSGJTEXHKIT-AWEZNQCLSA-N |
| XLogP | 3.01 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |