C8H10N2O — CID 126668289
2-ethyl-1,2-dihydrofuro[2,3-d]pyrimidine (PubChem CID 126668289) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 2-ethyl-1,2-dihydrofuro[2,3-d]pyrimidine.
| Compound Name | 2-ethyl-1,2-dihydrofuro[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 126668289 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 2-ethyl-1,2-dihydrofuro[2,3-d]pyrimidine |
| SMILES | CCC1N=Cc2ccoc2N1 |
| InChI | InChI=1S/C8H10N2O/c1-2-7-9-5-6-3-4-11-8(6)10-7/h3-5,7,10H,2H2,1H3 |
| InChIKey | SJDVDOFWMAALBQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |