C25H34N2O2 — CID 126671889
1-[[4-[4-(cyclopentyloxymethyl)phenyl]-2-methoxyphenyl]methyl]-4-methylpiperazine (PubChem CID 126671889) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[[4-[4-(cyclopentyloxymethyl)phenyl]-2-methoxyphenyl]methyl]-4-methylpiperazine.
| Compound Name | 1-[[4-[4-(cyclopentyloxymethyl)phenyl]-2-methoxyphenyl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 126671889 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 1-[[4-[4-(cyclopentyloxymethyl)phenyl]-2-methoxyphenyl]methyl]-4-methylpiperazine |
| SMILES | COc1cc(-c2ccc(COC3CCCC3)cc2)ccc1CN1CCN(C)CC1 |
| InChI | InChI=1S/C25H34N2O2/c1-26-13-15-27(16-14-26)18-23-12-11-22(17-25(23)28-2)21-9-7-20(8-10-21)19-29-24-5-3-4-6-24/h7-12,17,24H,3-6,13-16,18-19H2,1-2H3 |
| InChIKey | TYXWEXPMWOBPOO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |