C25H33ClN2O2 — CID 126675607
2-[4-[[3-chloro-4-[4-(cyclopentyloxymethyl)phenyl]phenyl]methyl]piperazin-1-yl]ethanol (PubChem CID 126675607) has the molecular formula C25H33ClN2O2 and a molecular weight of 429.00 g/mol. Its IUPAC name is 2-[4-[[3-chloro-4-[4-(cyclopentyloxymethyl)phenyl]phenyl]methyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[[3-chloro-4-[4-(cyclopentyloxymethyl)phenyl]phenyl]methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 126675607 |
| Molecular Formula | C25H33ClN2O2 |
| Molecular Weight | 429.00 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-[4-[[3-chloro-4-[4-(cyclopentyloxymethyl)phenyl]phenyl]methyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(Cc2ccc(-c3ccc(COC4CCCC4)cc3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C25H33ClN2O2/c26-25-17-21(18-28-13-11-27(12-14-28)15-16-29)7-10-24(25)22-8-5-20(6-9-22)19-30-23-3-1-2-4-23/h5-10,17,23,29H,1-4,11-16,18-19H2 |
| InChIKey | QHXGQQQFGREEDI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.00 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |