C19H22BrN3O3 — CID 126675206
5-bromo-N-methyl-1-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2-oxopyridine-3-carboxamide (PubChem CID 126675206) has the molecular formula C19H22BrN3O3 and a molecular weight of 420.31 g/mol. Its IUPAC name is 5-bromo-N-methyl-1-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2-oxopyridine-3-carboxamide.
| Compound Name | 5-bromo-N-methyl-1-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 126675206 |
| Molecular Formula | C19H22BrN3O3 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 5-bromo-N-methyl-1-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2-oxopyridine-3-carboxamide |
| SMILES | CNC(=O)c1cc(Br)cn(Cc2cccc(CN3CCOCC3)c2)c1=O |
| InChI | InChI=1S/C19H22BrN3O3/c1-21-18(24)17-10-16(20)13-23(19(17)25)12-15-4-2-3-14(9-15)11-22-5-7-26-8-6-22/h2-4,9-10,13H,5-8,11-12H2,1H3,(H,21,24) |
| InChIKey | CIDKOBFQAWPZEH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |