C18H23N5O — CID 126675392
2-amino-5-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]pyridine-3-carboxamide (PubChem CID 126675392) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-amino-5-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-amino-5-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126675392 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-amino-5-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]pyridine-3-carboxamide |
| SMILES | CN1CCN(Cc2cccc(-c3cnc(N)c(C(N)=O)c3)c2)CC1 |
| InChI | InChI=1S/C18H23N5O/c1-22-5-7-23(8-6-22)12-13-3-2-4-14(9-13)15-10-16(18(20)24)17(19)21-11-15/h2-4,9-11H,5-8,12H2,1H3,(H2,19,21)(H2,20,24) |
| InChIKey | KGUKQHCSBJVZGC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |