C19H21FN2O4 — CID 126676042
butyl 1-[(3-fluorophenyl)methyl]-5-(methylcarbamoyl)-6-oxopyridine-3-carboxylate (PubChem CID 126676042) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is butyl 1-[(3-fluorophenyl)methyl]-5-(methylcarbamoyl)-6-oxopyridine-3-carboxylate.
| Compound Name | butyl 1-[(3-fluorophenyl)methyl]-5-(methylcarbamoyl)-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 126676042 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | butyl 1-[(3-fluorophenyl)methyl]-5-(methylcarbamoyl)-6-oxopyridine-3-carboxylate |
| SMILES | CCCCOC(=O)c1cc(C(=O)NC)c(=O)n(Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H21FN2O4/c1-3-4-8-26-19(25)14-10-16(17(23)21-2)18(24)22(12-14)11-13-6-5-7-15(20)9-13/h5-7,9-10,12H,3-4,8,11H2,1-2H3,(H,21,23) |
| InChIKey | TUBAWVXKYLGZJR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|