C17H13F3N7O2+ — CID 126676237
imino-[4-[[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]amino]methyl]benzoyl]iminoazanium (PubChem CID 126676237) has the molecular formula C17H13F3N7O2+ and a molecular weight of 404.33 g/mol. Its IUPAC name is imino-[4-[[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]amino]methyl]benzoyl]iminoazanium.
| Compound Name | imino-[4-[[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]amino]methyl]benzoyl]iminoazanium |
|---|---|
| PubChem CID | 126676237 |
| Molecular Formula | C17H13F3N7O2+ |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | imino-[4-[[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]amino]methyl]benzoyl]iminoazanium |
| SMILES | N=[N+]=NC(=O)c1ccc(CNc2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C17H12F3N7O2/c18-17(19,20)29-14-7-5-13(6-8-14)27-10-23-16(25-27)22-9-11-1-3-12(4-2-11)15(28)24-26-21/h1-8,10H,9H2,(H-,21,24,28)/p+1 |
| InChIKey | UUWPSTRDOUVVIG-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|