C18H21ClN2 — CID 126676346
3-(3-chlorophenyl)-1-(3-ethylphenyl)piperazine (PubChem CID 126676346) has the molecular formula C18H21ClN2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-(3-ethylphenyl)piperazine.
| Compound Name | 3-(3-chlorophenyl)-1-(3-ethylphenyl)piperazine |
|---|---|
| PubChem CID | 126676346 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-(3-chlorophenyl)-1-(3-ethylphenyl)piperazine |
| SMILES | CCc1cccc(N2CCNC(c3cccc(Cl)c3)C2)c1 |
| InChI | InChI=1S/C18H21ClN2/c1-2-14-5-3-8-17(11-14)21-10-9-20-18(13-21)15-6-4-7-16(19)12-15/h3-8,11-12,18,20H,2,9-10,13H2,1H3 |
| InChIKey | NHWGZCYAKPPMCW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |