C12H17ClN2 — CID 82287491
5-(3-chlorophenyl)-1-methyl-1,4-diazepane (PubChem CID 82287491) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-1-methyl-1,4-diazepane.
| Compound Name | 5-(3-chlorophenyl)-1-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 82287491 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 5-(3-chlorophenyl)-1-methyl-1,4-diazepane |
| SMILES | CN1CCNC(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C12H17ClN2/c1-15-7-5-12(14-6-8-15)10-3-2-4-11(13)9-10/h2-4,9,12,14H,5-8H2,1H3 |
| InChIKey | ASYWKHCJJBVUGL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |