C23H25N5O6 — CID 126677702
5-[2-[[5-[3-(cyclohexanecarbonylamino)phenyl]-1,2-oxazole-3-carbonyl]amino]ethyl]-N-hydroxy-1,2-oxazole-3-carboxamide (PubChem CID 126677702) has the molecular formula C23H25N5O6 and a molecular weight of 467.48 g/mol. Its IUPAC name is 5-[2-[[5-[3-(cyclohexanecarbonylamino)phenyl]-1,2-oxazole-3-carbonyl]amino]ethyl]-N-hydroxy-1,2-oxazole-3-carboxamide.
| Compound Name | 5-[2-[[5-[3-(cyclohexanecarbonylamino)phenyl]-1,2-oxazole-3-carbonyl]amino]ethyl]-N-hydroxy-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 126677702 |
| Molecular Formula | C23H25N5O6 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 5-[2-[[5-[3-(cyclohexanecarbonylamino)phenyl]-1,2-oxazole-3-carbonyl]amino]ethyl]-N-hydroxy-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NO)c1cc(CCNC(=O)c2cc(-c3cccc(NC(=O)C4CCCCC4)c3)on2)on1 |
| InChI | InChI=1S/C23H25N5O6/c29-21(14-5-2-1-3-6-14)25-16-8-4-7-15(11-16)20-13-19(28-34-20)22(30)24-10-9-17-12-18(27-33-17)23(31)26-32/h4,7-8,11-14,32H,1-3,5-6,9-10H2,(H,24,30)(H,25,29)(H,26,31) |
| InChIKey | YXCTZWWALNJTTH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 159.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|