C37H34ClN5O — CID 126681647
2-[3-(aminomethyl)phenyl]-N-[3-[(10-chloroanthracen-9-yl)-(cyclopropylmethylamino)methyl]phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 126681647) has the molecular formula C37H34ClN5O and a molecular weight of 600.17 g/mol. Its IUPAC name is 2-[3-(aminomethyl)phenyl]-N-[3-[(10-chloroanthracen-9-yl)-(cyclopropylmethylamino)methyl]phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-[3-(aminomethyl)phenyl]-N-[3-[(10-chloroanthracen-9-yl)-(cyclopropylmethylamino)methyl]phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126681647 |
| Molecular Formula | C37H34ClN5O |
| Molecular Weight | 600.17 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 2-[3-(aminomethyl)phenyl]-N-[3-[(10-chloroanthracen-9-yl)-(cyclopropylmethylamino)methyl]phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(NCC3CC3)c3c4ccccc4c(Cl)c4ccccc34)c2)n(-c2cccc(CN)c2)n1 |
| InChI | InChI=1S/C37H34ClN5O/c1-23-18-33(43(42-23)28-11-6-8-25(19-28)21-39)37(44)41-27-10-7-9-26(20-27)36(40-22-24-16-17-24)34-29-12-2-4-14-31(29)35(38)32-15-5-3-13-30(32)34/h2-15,18-20,24,36,40H,16-17,21-22,39H2,1H3,(H,41,44) |
| InChIKey | GKCWLJCPKBUEJR-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.17 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|